cas: 7461-12-3 — see every product listed under this CAS number, including other names
8–Nitroquinolin–2(1H)–one (CAS 7461-12-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF17403-100mg |
| cas | 7461-12-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 573.64 Pln | |
| GLPBio | 1g | 1388.04 Pln | |
| GLPBio | 250mg | 723.41 Pln | |
| GLPBio | 5g | 3129.19 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
8-nitro-1H-quinolin-2-one (CAS 7461-12-3) is a chemical compound with the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. IUPAC name: 8-nitro-1H-quinolin-2-one. InChIKey: LPIFZNBFLQNYIA-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O3 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 8-nitro-1H-quinolin-2-one |
| InChIKey | LPIFZNBFLQNYIA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)[N+](=O)[O-])NC(=O)C=C2 |
Computed by PubChem (NCBI)