cas: 1194375-12-6 — see every product listed under this CAS number, including other names
8-BROMOIMIDAZO[1,2-A]PYRIDINE-2-CARBALDEHYDE, 97% (CAS 1194375-12-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F303995-100MG |
| cas | 1194375-12-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 174.96 Pln | |
| Fluorochem | 250mg | 258.26 Pln | |
| Fluorochem | 1g | 539.41 Pln | |
| Fluorochem | 5g | 1872.28 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
8-bromoimidazo[1,2-a]pyridine-2-carbaldehyde (CAS 1194375-12-6) is a chemical compound with the molecular formula C8H5BrN2O and a molecular weight of 225.04 g/mol. IUPAC name: 8-bromoimidazo[1,2-a]pyridine-2-carbaldehyde. InChIKey: DDCSWBYPSZSEHW-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O |
|---|---|
| Molecular weight | 225.04 g/mol |
| IUPAC name | 8-bromoimidazo[1,2-a]pyridine-2-carbaldehyde |
| InChIKey | DDCSWBYPSZSEHW-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(N=C2C(=C1)Br)C=O |
Computed by PubChem (NCBI)