cas: 851325-42-3 — see every product listed under this CAS number, including other names
8-Boc-2,8-Diazaspiro[4.5]decane (hydrochloride), 97.0% (CAS 851325-42-3) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 100 mg, 500 mg, 250 mg, 50 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-30592-1 g |
| cas | 851325-42-3 |
| size | 1 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 1243.85 Pln | |
| MedChemExpress | 100 mg | 510.10 Pln | |
| MedChemExpress | 500 mg | 983.78 Pln | |
| MedChemExpress | 250 mg | 784.09 Pln | |
| MedChemExpress | 50 mg | 370.78 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 97.0% |
Tert-butyl 2,8-diazaspiro[4.5]decane-8-carboxylate;hydrochloride (CAS 851325-42-3) is a chemical compound with the molecular formula C13H25ClN2O2 and a molecular weight of 276.80 g/mol. IUPAC name: tert-butyl 2,8-diazaspiro[4.5]decane-8-carboxylate;hydrochloride. InChIKey: WZWUCNJUMVSAJD-UHFFFAOYSA-N.
| Molecular formula | C13H25ClN2O2 |
|---|---|
| Molecular weight | 276.80 g/mol |
| IUPAC name | tert-butyl 2,8-diazaspiro[4.5]decane-8-carboxylate;hydrochloride |
| InChIKey | WZWUCNJUMVSAJD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCNC2)CC1.Cl |
Computed by PubChem (NCBI)