8-Bromo-1-Naphthoic Acid, 97%
cas: 1729-99-3 — see every product listed under this CAS number, including other names
8-Bromo-1-Naphthoic Acid, 97% (CAS 1729-99-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114NHL-250mg |
| cas | 1729-99-3 |
| size | 250mg |
| availability | 500g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 261.20 Pln | |
| Chemat | 10g | 453.20 Pln | |
| Chemat | 25g | 957.20 Pln | |
| Chemat | 50g | 1821.20 Pln | |
| Chemat | 100g | 3506.00 Pln | |
| Chemat | 250g | 5958.80 Pln | |
| Chemat | 500g | 11198.40 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
8-bromonaphthalene-1-carboxylic acid (CAS 1729-99-3) is a chemical compound with the molecular formula C11H7BrO2 and a molecular weight of 251.08 g/mol. IUPAC name: 8-bromonaphthalene-1-carboxylic acid. InChIKey: DMEZDDHJCUHENA-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO2 |
|---|---|
| Molecular weight | 251.08 g/mol |
| IUPAC name | 8-bromonaphthalene-1-carboxylic acid |
| InChIKey | DMEZDDHJCUHENA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)C(=O)O)C(=CC=C2)Br |
Computed by PubChem (NCBI)