cas: 956100-63-3 — see every product listed under this CAS number, including other names
8-Bromo-2-chloroquinazoline 97% (CAS 956100-63-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A208719-100mg |
| cas | 956100-63-3 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 125.62 Pln | |
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 5g | 464.94 Pln | |
| Ambeed | 10g | 776.44 Pln | |
| Ambeed | 25g | 1744.31 Pln | |
| Ambeed | 100g | 5938.44 Pln | |
| Ambeed | 500g | 23532.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A208719 |
8-bromo-2-chloroquinazoline (CAS 956100-63-3) is a chemical compound with the molecular formula C8H4BrClN2 and a molecular weight of 243.49 g/mol. IUPAC name: 8-bromo-2-chloroquinazoline. InChIKey: BFDGSOGSXIFDNF-UHFFFAOYSA-N.
| Molecular formula | C8H4BrClN2 |
|---|---|
| Molecular weight | 243.49 g/mol |
| IUPAC name | 8-bromo-2-chloroquinazoline |
| InChIKey | BFDGSOGSXIFDNF-UHFFFAOYSA-N |
| SMILES | C1=CC2=CN=C(N=C2C(=C1)Br)Cl |
Computed by PubChem (NCBI)