cas: 35966-16-6 — see every product listed under this CAS number, including other names
8-Chloro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid, ≥98%, ≥98% (CAS 35966-16-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BYKJ-100mg |
| cas | 35966-16-6 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 390.80 Pln | |
| Chemat | 250mg | 722.00 Pln | |
| Chemat | 1g | 1686.80 Pln | |
| Chemat | 5g | 6554.00 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
8-chloro-4-oxo-1H-quinoline-3-carboxylic acid (CAS 35966-16-6) is a chemical compound with the molecular formula C10H6ClNO3 and a molecular weight of 223.61 g/mol. IUPAC name: 8-chloro-4-oxo-1H-quinoline-3-carboxylic acid. InChIKey: MQDCOKGAQYWIDE-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO3 |
|---|---|
| Molecular weight | 223.61 g/mol |
| IUPAC name | 8-chloro-4-oxo-1H-quinoline-3-carboxylic acid |
| InChIKey | MQDCOKGAQYWIDE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)NC=C(C2=O)C(=O)O |
Computed by PubChem (NCBI)