CAS 1065102-51-3 appears in our catalog under these names: 2-(4-Chlorophenyl)oxazole-4-carboxylic acid, 95%, 2-(4-Chlorophenyl)oxazole-4-carboxylic Acid, 95+%, 2-(4-Chlorophenyl)oxazole-4-carboxylic acid, 2-(4-Chlorophenyl)oxazole-4-carboxylic Acid, ≥95%, ≥95%, 2-(4-Chlorophenyl)oxazole-4-carboxylic acid, ≥95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-(4-chlorophenyl)-1,3-oxazole-4-carboxylic acid (CAS 1065102-51-3) is a chemical compound with the molecular formula C10H6ClNO3 and a molecular weight of 223.61 g/mol. IUPAC name: 2-(4-chlorophenyl)-1,3-oxazole-4-carboxylic acid. InChIKey: AUTVMMYIVCLSMR-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO3 |
|---|---|
| Molecular weight | 223.61 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-1,3-oxazole-4-carboxylic acid |
| InChIKey | AUTVMMYIVCLSMR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=CO2)C(=O)O)Cl |
Computed by PubChem (NCBI)