CAS 143659-14-7 is the registry number for 5-(4-Chlorophenyl)oxazole-4-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
5-(4-chlorophenyl)-1,3-oxazole-4-carboxylic acid (CAS 143659-14-7) is a chemical compound with the molecular formula C10H6ClNO3 and a molecular weight of 223.61 g/mol. IUPAC name: 5-(4-chlorophenyl)-1,3-oxazole-4-carboxylic acid. InChIKey: WGPXKQGURSURNU-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO3 |
|---|---|
| Molecular weight | 223.61 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-1,3-oxazole-4-carboxylic acid |
| InChIKey | WGPXKQGURSURNU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(N=CO2)C(=O)O)Cl |
Computed by PubChem (NCBI)