CAS 887408-09-5 appears in our catalog under these names: 5-(4-Chlorophenyl)isoxazole-4-carboxylic acid, 5-(4-Chlorophenyl)-1,2-oxazole-4-carboxylic acid, 95%, 5-(4-chlorophenyl)-1,2-oxazole-4-carboxylic acid. Offered by: Biosynth, Combi-blocks, Chemat. Available pack sizes: 5g, 0,5g, 10g, 1g, 250mg, 1mg, 5mg.
5-(4-chlorophenyl)-1,2-oxazole-4-carboxylic acid (CAS 887408-09-5) is a chemical compound with the molecular formula C10H6ClNO3 and a molecular weight of 223.61 g/mol. IUPAC name: 5-(4-chlorophenyl)-1,2-oxazole-4-carboxylic acid. InChIKey: QYWAKMRGJVKMRO-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO3 |
|---|---|
| Molecular weight | 223.61 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-1,2-oxazole-4-carboxylic acid |
| InChIKey | QYWAKMRGJVKMRO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=NO2)C(=O)O)Cl |
Computed by PubChem (NCBI)