cas: 178488-36-3 — see every product listed under this CAS number, including other names
8-Chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridine, 96%, 96% (CAS 178488-36-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BAGE-100mg |
| cas | 178488-36-3 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 250mg | 83.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridine (CAS 178488-36-3) is a chemical compound with the molecular formula C8H4ClF3N2 and a molecular weight of 220.58 g/mol. IUPAC name: 8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridine. InChIKey: BWSHPRLSCABXRL-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3N2 |
|---|---|
| Molecular weight | 220.58 g/mol |
| IUPAC name | 8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridine |
| InChIKey | BWSHPRLSCABXRL-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(C=C(C2=N1)Cl)C(F)(F)F |
Computed by PubChem (NCBI)