CAS 34408-14-5 appears in our catalog under these names: 8–Chloroadenosine, 8-Chloroadenosine, 95%, 8-Chloroadenosine, 8-Chloroadenosine/ 99.48% (existing batch purity), 8-Chloroadenosine 99%. Offered by: GLPBio, Combi-blocks, TRC, TargetMol, Biosynth. Available pack sizes: 5mg, 100mg, 250mg, 1mg, 2mg, 10mg, 25mg, 50mg.
(2R,3R,4S,5R)-2-(6-amino-8-chloropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (CAS 34408-14-5) is a chemical compound with the molecular formula C10H12ClN5O4 and a molecular weight of 301.69 g/mol. IUPAC name: (2R,3R,4S,5R)-2-(6-amino-8-chloropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: MHDPPLULTMGBSI-UUOKFMHZSA-N.
| Molecular formula | C10H12ClN5O4 |
|---|---|
| Molecular weight | 301.69 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-(6-amino-8-chloropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | MHDPPLULTMGBSI-UUOKFMHZSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C(=N2)Cl)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N |
Computed by PubChem (NCBI)