cas: 204782-93-4 — see every product listed under this CAS number, including other names
8-FLUOROQUINOLINE-5-CARBOXYLIC ACID, 95% (CAS 204782-93-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F303649-250MG |
| cas | 204782-93-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1346.42 Pln | |
| Fluorochem | 1g | 3267.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
8-fluoroquinoline-5-carboxylic acid (CAS 204782-93-4) is a chemical compound with the molecular formula C10H6FNO2 and a molecular weight of 191.16 g/mol. IUPAC name: 8-fluoroquinoline-5-carboxylic acid. InChIKey: GCKAHUABSFTSDF-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO2 |
|---|---|
| Molecular weight | 191.16 g/mol |
| IUPAC name | 8-fluoroquinoline-5-carboxylic acid |
| InChIKey | GCKAHUABSFTSDF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N=C1)F)C(=O)O |
Computed by PubChem (NCBI)