cas: 63149-33-7 — see every product listed under this CAS number, including other names
8-Hydroxy-1,2,3,5,6,7-hexahydropyrido[3,2,1-ij]quinoline-9-carbaldehyde, 98% (CAS 63149-33-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F240265-1G |
| cas | 63149-33-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 508.17 Pln | |
| Fluorochem | 10g | 862.21 Pln | |
| Fluorochem | 25g | 1762.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
6-hydroxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-triene-7-carbaldehyde (CAS 63149-33-7) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: 6-hydroxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-triene-7-carbaldehyde. InChIKey: NRZXBDYODHLZBF-UHFFFAOYSA-N.
| Molecular formula | C13H15NO2 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | 6-hydroxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-triene-7-carbaldehyde |
| InChIKey | NRZXBDYODHLZBF-UHFFFAOYSA-N |
| SMILES | C1CC2=CC(=C(C3=C2N(C1)CCC3)O)C=O |
Computed by PubChem (NCBI)