8-Nitroquinolin-5-ol, 97%
cas: 129717-35-7 — see every product listed under this CAS number, including other names
8-Nitroquinolin-5-ol, 97% (CAS 129717-35-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F651571-50MG |
| cas | 129717-35-7 |
| size | 50mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 227.02 Pln | |
| Fluorochem | 100mg | 325.94 Pln | |
| Fluorochem | 250mg | 544.62 Pln | |
| Fluorochem | 500mg | 1023.62 Pln | |
| Fluorochem | 1g | 1393.28 Pln | |
| Fluorochem | 2.5g | 2809.45 Pln | |
| Fluorochem | 5g | 3934.05 Pln | |
| Fluorochem | 10g | 6037.48 Pln | |
| Chemat | 100mg | 275.60 Pln | |
| Chemat | 250mg | 400.40 Pln | |
| Chemat | 500mg | 669.20 Pln | |
| Chemat | 1g | 995.60 Pln | |
| Chemat | 5g | 3347.60 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
8-nitroquinolin-5-ol (CAS 129717-35-7) is a chemical compound with the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. IUPAC name: 8-nitroquinolin-5-ol. InChIKey: GBFQOBPPJULZSN-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O3 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 8-nitroquinolin-5-ol |
| InChIKey | GBFQOBPPJULZSN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N=C1)[N+](=O)[O-])O |
Computed by PubChem (NCBI)