cas: 1408075-94-4 — see every product listed under this CAS number, including other names
8-aminomethyl-3-boc-3-azabicyclo[3.2.1]octane hydrochloride, 97% (CAS 1408075-94-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F517196-100MG |
| cas | 1408075-94-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 2486.64 Pln | |
| Fluorochem | 250mg | 3939.26 Pln | |
| Fluorochem | 500mg | 6511.27 Pln | |
| Fluorochem | 1g | 9718.47 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 8-(aminomethyl)-3-azabicyclo[3.2.1]octane-3-carboxylate;hydrochloride (CAS 1408075-94-4) is a chemical compound with the molecular formula C13H25ClN2O2 and a molecular weight of 276.80 g/mol. IUPAC name: tert-butyl 8-(aminomethyl)-3-azabicyclo[3.2.1]octane-3-carboxylate;hydrochloride. InChIKey: HLMHBVVUMBLUHN-UHFFFAOYSA-N.
| Molecular formula | C13H25ClN2O2 |
|---|---|
| Molecular weight | 276.80 g/mol |
| IUPAC name | tert-butyl 8-(aminomethyl)-3-azabicyclo[3.2.1]octane-3-carboxylate;hydrochloride |
| InChIKey | HLMHBVVUMBLUHN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2CCC(C1)C2CN.Cl |
Computed by PubChem (NCBI)