cas: 29851-57-8 — see every product listed under this CAS number, including other names
8-oxoadenosine, 98% (CAS 29851-57-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F866477-250MG |
| cas | 29851-57-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1034.03 Pln | |
| Fluorochem | 1g | 3689.34 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7H-purin-8-one (CAS 29851-57-8) is a chemical compound with the molecular formula C10H13N5O5 and a molecular weight of 283.24 g/mol. IUPAC name: 6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7H-purin-8-one. InChIKey: UEHOMUNTZPIBIL-UUOKFMHZSA-N.
| Molecular formula | C10H13N5O5 |
|---|---|
| Molecular weight | 283.24 g/mol |
| IUPAC name | 6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7H-purin-8-one |
| InChIKey | UEHOMUNTZPIBIL-UUOKFMHZSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C(=O)N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N |
Computed by PubChem (NCBI)