cas: 1391732-45-8 — see every product listed under this CAS number, including other names
8-tert-Butyl 2-methyl 8-azaspiro(4.5)decane-2,8-dicarboxylate, 98+% (CAS 1391732-45-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A410556-5g |
| cas | 1391732-45-8 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 19313.56 Pln | |
| AmBeed | 1g | 7882.00 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
8-O-tert-butyl 3-O-methyl 8-azaspiro[4.5]decane-3,8-dicarboxylate (CAS 1391732-45-8) is a chemical compound with the molecular formula C16H27NO4 and a molecular weight of 297.39 g/mol. IUPAC name: 8-O-tert-butyl 3-O-methyl 8-azaspiro[4.5]decane-3,8-dicarboxylate. InChIKey: MTIWDIYQTBHBSX-UHFFFAOYSA-N.
| Molecular formula | C16H27NO4 |
|---|---|
| Molecular weight | 297.39 g/mol |
| IUPAC name | 8-O-tert-butyl 3-O-methyl 8-azaspiro[4.5]decane-3,8-dicarboxylate |
| InChIKey | MTIWDIYQTBHBSX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCC(C2)C(=O)OC)CC1 |
Computed by PubChem (NCBI)