cas: 27918-14-5 — see every product listed under this CAS number, including other names
9(10H)-Acridinone, 2-amino-, 97%, 97% (CAS 27918-14-5) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114GJ4-5mg |
| cas | 27918-14-5 |
| size | 5mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 242.00 Pln | |
| Chemat | 25mg | 477.20 Pln | |
| Chemat | 50mg | 597.20 Pln | |
| Chemat | 100mg | 856.40 Pln | |
| Chemat | 250mg | 1442.00 Pln | |
| Chemat | 1g | 2958.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-Aminoacridone is a member of acridines. It is functionally related to an acridone.
Source: ChEBI
| Molecular formula | C13H10N2O |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 2-amino-10H-acridin-9-one |
| InChIKey | PIGCSKVALLVWKU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(N2)C=CC(=C3)N |
Computed by PubChem (NCBI)