cas: 89929-27-1 — see every product listed under this CAS number, including other names
9,10-Dihydroxy-3-Isobutyl-3,4,6,7-Tetrahydro-1H-Pyrido[2,1-a]Isoquinolin-2(11bH)-One, 97%, 97% (CAS 89929-27-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H3P4-250mg |
| cas | 89929-27-1 |
| size | 250mg |
| availability | 590g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 251.60 Pln | |
| Chemat | 5g | 808.40 Pln | |
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 10g | 1350.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
9,10-dihydroxy-3-(2-methylpropyl)-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-one (CAS 89929-27-1) is a chemical compound with the molecular formula C17H23NO3 and a molecular weight of 289.4 g/mol. IUPAC name: 9,10-dihydroxy-3-(2-methylpropyl)-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-one. InChIKey: HKXSWCIZVQFEQQ-UHFFFAOYSA-N.
| Molecular formula | C17H23NO3 |
|---|---|
| Molecular weight | 289.4 g/mol |
| IUPAC name | 9,10-dihydroxy-3-(2-methylpropyl)-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-one |
| InChIKey | HKXSWCIZVQFEQQ-UHFFFAOYSA-N |
| SMILES | CC(C)CC1CN2CCC3=CC(=C(C=C3C2CC1=O)O)O |
Computed by PubChem (NCBI)