Products 2220998-55-8
CAS 2220998-55-8 is the registry number for DTR-I. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 50mg, 25mg.
(3S,11bS)-9,10-dihydroxy-3-(2-methylpropyl)-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-one (CAS 2220998-55-8) is a chemical compound with the molecular formula C17H23NO3 and a molecular weight of 289.4 g/mol. IUPAC name: (3S,11bS)-9,10-dihydroxy-3-(2-methylpropyl)-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-one. InChIKey: HKXSWCIZVQFEQQ-JSGCOSHPSA-N.
| Molecular formula | C17H23NO3 |
|---|---|
| Molecular weight | 289.4 g/mol |
| IUPAC name | (3S,11bS)-9,10-dihydroxy-3-(2-methylpropyl)-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-one |
| InChIKey | HKXSWCIZVQFEQQ-JSGCOSHPSA-N |
| SMILES | CC(C)C[C@H]1CN2CCC3=CC(=C(C=C3[C@@H]2CC1=O)O)O |
Computed by PubChem (NCBI)