9,11-Dehydro Ethynyl Estradiol, 95+%
cas: 1231-96-5 — see every product listed under this CAS number, including other names
9,11-Dehydro Ethynyl Estradiol, 95+% (CAS 1231-96-5) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A280033-5mg |
| cas | 1231-96-5 |
| size | 5mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5mg | 604.00 Pln | |
| Ambeed | 10mg | 793.12 Pln | |
| Ambeed | 25mg | 1594.12 Pln | |
| Ambeed | 50mg | 2517.50 Pln | |
| Ambeed | 100mg | 3980.44 Pln | |
| Ambeed | 250mg | 7518.19 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
(8S,13S,14S,17R)-17-ethynyl-13-methyl-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (CAS 1231-96-5) is a chemical compound with the molecular formula C20H22O2 and a molecular weight of 294.4 g/mol. IUPAC name: (8S,13S,14S,17R)-17-ethynyl-13-methyl-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-3,17-diol. InChIKey: DUZHXWCAIBMQPI-FYQPLNBISA-N.
| Molecular formula | C20H22O2 |
|---|---|
| Molecular weight | 294.4 g/mol |
| IUPAC name | (8S,13S,14S,17R)-17-ethynyl-13-methyl-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| InChIKey | DUZHXWCAIBMQPI-FYQPLNBISA-N |
| SMILES | C[C@]12CC=C3[C@H]([C@@H]1CC[C@]2(C#C)O)CCC4=C3C=CC(=C4)O |
Computed by PubChem (NCBI)
Synonyms:
9,11-Dehydro Ethynyl Estradiol, 9,11-Dehydro ethynylestradiol, Ethinylestradiol impurity B [EP], Ethinylestradiol specified impurity B [EP], 19-Nor-17alpha-pregna-1,3,5(10),9(11)-tetraen-20-yne-3,17-diol, 19-Norpregna-1,3,5(10),9(11)-tetraen-20-yne-3,17-diol, (17alpha)-, ETHINYLESTRADIOL IMPURITY B [EP IMPURITY], ETHINYLESTRADIOL IMPURITY B (EP IMPURITY), Ethinylestradiol impurity B, Ethinylestradiol specified impurity B