CAS 79135-58-3 appears in our catalog under these names: 1,2–bis(4–isopropylphenyl)ethane–1,2–dione, 1,2-bis(4-isopropylphenyl)ethane-1,2-dione, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 5g, 1g.
1,2-bis(4-propan-2-ylphenyl)ethane-1,2-dione (CAS 79135-58-3) is a chemical compound with the molecular formula C20H22O2 and a molecular weight of 294.4 g/mol. IUPAC name: 1,2-bis(4-propan-2-ylphenyl)ethane-1,2-dione. InChIKey: LVSZQGATCLRLCP-UHFFFAOYSA-N.
| Molecular formula | C20H22O2 |
|---|---|
| Molecular weight | 294.4 g/mol |
| IUPAC name | 1,2-bis(4-propan-2-ylphenyl)ethane-1,2-dione |
| InChIKey | LVSZQGATCLRLCP-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C(=O)C(=O)C2=CC=C(C=C2)C(C)C |
Computed by PubChem (NCBI)