Products 137233-87-5

CAS 137233-87-5 is the registry number for 1,2,3,6,7,8-Hexahydro-1-pyreneacetic Acid Ethyl Ester. Offered by: TRC. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

Ethyl 2-(1,2,3,6,7,8-hexahydropyren-1-yl)acetate (CAS 137233-87-5) is a chemical compound with the molecular formula C20H22O2 and a molecular weight of 294.4 g/mol. IUPAC name: ethyl 2-(1,2,3,6,7,8-hexahydropyren-1-yl)acetate. InChIKey: CPFCQWABWWLNDQ-UHFFFAOYSA-N.

Identity
Molecular formulaC20H22O2
Molecular weight294.4 g/mol
IUPAC nameethyl 2-(1,2,3,6,7,8-hexahydropyren-1-yl)acetate
InChIKeyCPFCQWABWWLNDQ-UHFFFAOYSA-N
SMILESCCOC(=O)CC1CCC2=C3C1=CC=C4C3=C(CCC4)C=C2

Computed by PubChem (NCBI)