Products 205252-57-9
CAS 205252-57-9 appears in our catalog under these names: 9-cis-UAB30, (2E,4E,6Z,8E)-8-(3,4-Dihydro-2H-naphthalen-1-ylidene)-3,7-dimethylocta-2,4,6-trienoic acid. Offered by: MedChemExpress, Biosynth. Available pack sizes: Get quote, 25mg, 50mg, 100mg.
(2E,4E,6Z,8E)-8-(3,4-dihydro-2H-naphthalen-1-ylidene)-3,7-dimethylocta-2,4,6-trienoic acid (CAS 205252-57-9) is a chemical compound with the molecular formula C20H22O2 and a molecular weight of 294.4 g/mol. IUPAC name: (2E,4E,6Z,8E)-8-(3,4-dihydro-2H-naphthalen-1-ylidene)-3,7-dimethylocta-2,4,6-trienoic acid. InChIKey: PPGNMFUMZSAZCW-VOYUZAMQSA-N.
| Molecular formula | C20H22O2 |
|---|---|
| Molecular weight | 294.4 g/mol |
| IUPAC name | (2E,4E,6Z,8E)-8-(3,4-dihydro-2H-naphthalen-1-ylidene)-3,7-dimethylocta-2,4,6-trienoic acid |
| InChIKey | PPGNMFUMZSAZCW-VOYUZAMQSA-N |
| SMILES | C/C(=C\C(=O)O)/C=C/C=C(/C)\C=C\1/CCCC2=CC=CC=C21 |
Computed by PubChem (NCBI)