cas: 182121-12-6 — see every product listed under this CAS number, including other names
9,9-Bis(methoxymethyl)-9H-fluorene, 97% (CAS 182121-12-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F320532-250MG |
| cas | 182121-12-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 195.78 Pln | |
| Fluorochem | 10g | 294.71 Pln | |
| Fluorochem | 25g | 482.14 Pln | |
| Fluorochem | 100g | 1393.28 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
9,9-bis(methoxymethyl)fluorene (CAS 182121-12-6) is a chemical compound with the molecular formula C17H18O2 and a molecular weight of 254.32 g/mol. IUPAC name: 9,9-bis(methoxymethyl)fluorene. InChIKey: ZWINORFLMHROGF-UHFFFAOYSA-N.
| Molecular formula | C17H18O2 |
|---|---|
| Molecular weight | 254.32 g/mol |
| IUPAC name | 9,9-bis(methoxymethyl)fluorene |
| InChIKey | ZWINORFLMHROGF-UHFFFAOYSA-N |
| SMILES | COCC1(C2=CC=CC=C2C3=CC=CC=C31)COC |
Computed by PubChem (NCBI)