cas: 6267-02-3 — see every product listed under this CAS number, including other names
9,9-Dimethyl-9,10-dihydroacridine 98% (CAS 6267-02-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A275348-250mg |
| cas | 6267-02-3 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 209.06 Pln | |
| Ambeed | 10g | 337.00 Pln | |
| Ambeed | 25g | 726.38 Pln | |
| Ambeed | 100g | 2662.12 Pln | |
| Ambeed | 500g | 11962.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A275348 |
9,9-dimethyl-10H-acridine (CAS 6267-02-3) is a chemical compound with the molecular formula C15H15N and a molecular weight of 209.29 g/mol. IUPAC name: 9,9-dimethyl-10H-acridine. InChIKey: JSEQNGYLWKBMJI-UHFFFAOYSA-N.
| Molecular formula | C15H15N |
|---|---|
| Molecular weight | 209.29 g/mol |
| IUPAC name | 9,9-dimethyl-10H-acridine |
| InChIKey | JSEQNGYLWKBMJI-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2NC3=CC=CC=C31)C |
Computed by PubChem (NCBI)