9,9-dimethylcarbazine, 98%
cas: 6267-02-3 — see every product listed under this CAS number, including other names
9,9-dimethylcarbazine, 98% (CAS 6267-02-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114A7R-250mg |
| cas | 6267-02-3 |
| size | 250mg |
| availability | 1000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 141.20 Pln | |
| Chemat | 10g | 213.20 Pln | |
| Chemat | 25g | 434.00 Pln | |
| Chemat | 50g | 798.80 Pln | |
| Chemat | 100g | 1509.20 Pln | |
| Chemat | 250g | 3506.00 Pln | |
| Chemat | 500g | 6004.80 Pln | |
| Chemat | 1kg | 8296.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
9,9-dimethyl-10H-acridine (CAS 6267-02-3) is a chemical compound with the molecular formula C15H15N and a molecular weight of 209.29 g/mol. IUPAC name: 9,9-dimethyl-10H-acridine. InChIKey: JSEQNGYLWKBMJI-UHFFFAOYSA-N.
| Molecular formula | C15H15N |
|---|---|
| Molecular weight | 209.29 g/mol |
| IUPAC name | 9,9-dimethyl-10H-acridine |
| InChIKey | JSEQNGYLWKBMJI-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2NC3=CC=CC=C31)C |
Computed by PubChem (NCBI)
