cas: 23674-20-6 — see every product listed under this CAS number, including other names
9-Bromo-10-Phenylanthracene, 99%, 99% (CAS 23674-20-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113O52-1g |
| cas | 23674-20-6 |
| size | 1g |
| availability | 182g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 10g | 126.80 Pln | |
| Chemat | 25g | 198.80 Pln | |
| Chemat | 100g | 544.40 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
9-bromo-10-phenylanthracene (CAS 23674-20-6) is a chemical compound with the molecular formula C20H13Br and a molecular weight of 333.2 g/mol. IUPAC name: 9-bromo-10-phenylanthracene. InChIKey: WHGGVVHVBFMGSG-UHFFFAOYSA-N.
| Molecular formula | C20H13Br |
|---|---|
| Molecular weight | 333.2 g/mol |
| IUPAC name | 9-bromo-10-phenylanthracene |
| InChIKey | WHGGVVHVBFMGSG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C3C=CC=CC3=C(C4=CC=CC=C42)Br |
Computed by PubChem (NCBI)