cas: 23674-20-6 — see every product listed under this CAS number, including other names
9-Bromo-10-phenylanthracene 98% (CAS 23674-20-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A111145-1g |
| cas | 23674-20-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 275.81 Pln | |
| Ambeed | 100g | 854.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A111145 |
9-bromo-10-phenylanthracene (CAS 23674-20-6) is a chemical compound with the molecular formula C20H13Br and a molecular weight of 333.2 g/mol. IUPAC name: 9-bromo-10-phenylanthracene. InChIKey: WHGGVVHVBFMGSG-UHFFFAOYSA-N.
| Molecular formula | C20H13Br |
|---|---|
| Molecular weight | 333.2 g/mol |
| IUPAC name | 9-bromo-10-phenylanthracene |
| InChIKey | WHGGVVHVBFMGSG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C3C=CC=CC3=C(C4=CC=CC=C42)Br |
Computed by PubChem (NCBI)