cas: 1564-64-3 — see every product listed under this CAS number, including other names
9-Bromoanthracene 98% (CAS 1564-64-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A157372-5g |
| cas | 1564-64-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 10g | 131.19 Pln | |
| Ambeed | 25g | 203.50 Pln | |
| Ambeed | 100g | 331.44 Pln | |
| Ambeed | 500g | 1316.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A157372 |
9-bromoanthracene (CAS 1564-64-3) is a chemical compound with the molecular formula C14H9Br and a molecular weight of 257.12 g/mol. IUPAC name: 9-bromoanthracene. InChIKey: ZIRVQSRSPDUEOJ-UHFFFAOYSA-N.
| Molecular formula | C14H9Br |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | 9-bromoanthracene |
| InChIKey | ZIRVQSRSPDUEOJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C3C=CC=CC3=C2Br |
Computed by PubChem (NCBI)