CAS 7397-92-4 appears in our catalog under these names: 1-Bromoanthracene, 95%, 1-Bromoanthracene, >95% (HPLC), 1-Bromoanthracene, 97%, 1–Bromoanthracene, 1-Bromoanthracene, >97.0%(GC). Offered by: Combi-blocks, TRC, AmBeed, GLPBio, TCI. Available pack sizes: 100mg, 500mg, 10mg, 1mg, 2mg, 50mg, 1g, 250mg.
1-bromoanthracene (CAS 7397-92-4) is a chemical compound with the molecular formula C14H9Br and a molecular weight of 257.12 g/mol. IUPAC name: 1-bromoanthracene. InChIKey: XMWJLKOCNKJERQ-UHFFFAOYSA-N.
| Molecular formula | C14H9Br |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | 1-bromoanthracene |
| InChIKey | XMWJLKOCNKJERQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C(=CC2=C1)C=CC=C3Br |
Computed by PubChem (NCBI)