cas: 1564-64-3 — see every product listed under this CAS number, including other names
9-Bromoanthracene, >99.0%(GC)(HPLC) (CAS 1564-64-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B2871-5G |
| cas | 1564-64-3 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 157.68 Pln | |
| TCI | 25g | 496.97 Pln | |
| TCI | 100g | 1568.93 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >99.0%(GC)(HPLC) |
9-bromoanthracene (CAS 1564-64-3) is a chemical compound with the molecular formula C14H9Br and a molecular weight of 257.12 g/mol. IUPAC name: 9-bromoanthracene. InChIKey: ZIRVQSRSPDUEOJ-UHFFFAOYSA-N.
| Molecular formula | C14H9Br |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | 9-bromoanthracene |
| InChIKey | ZIRVQSRSPDUEOJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C3C=CC=CC3=C2Br |
Computed by PubChem (NCBI)