CAS 1564-64-3 appears in our catalog under these names: 9-Bromoanthracene, 97%, 9-Bromoanthracene, >95% (HPLC), 9–Bromoanthracene, 9-Bromoanthracene, 96% , 9-Bromoanthracene. Offered by: Combi-blocks, TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 100g, 25g, 500g, 5g, 10g.
9-bromoanthracene (CAS 1564-64-3) is a chemical compound with the molecular formula C14H9Br and a molecular weight of 257.12 g/mol. IUPAC name: 9-bromoanthracene. InChIKey: ZIRVQSRSPDUEOJ-UHFFFAOYSA-N.
| Molecular formula | C14H9Br |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | 9-bromoanthracene |
| InChIKey | ZIRVQSRSPDUEOJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C3C=CC=CC3=C2Br |
Computed by PubChem (NCBI)