cas: 947-72-8 — see every product listed under this CAS number, including other names
9-Chlorophenanthrene 95% (CAS 947-72-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A549606-100mg |
| cas | 947-72-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 542.81 Pln | |
| Ambeed | 250mg | 854.31 Pln | |
| Ambeed | 1g | 1905.62 Pln | |
| Ambeed | 5g | 5098.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A549606 |
9-chlorophenanthrene (CAS 947-72-8) is a chemical compound with the molecular formula C14H9Cl and a molecular weight of 212.67 g/mol. IUPAC name: 9-chlorophenanthrene. InChIKey: CJWHZQNUDAJJSB-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl |
|---|---|
| Molecular weight | 212.67 g/mol |
| IUPAC name | 9-chlorophenanthrene |
| InChIKey | CJWHZQNUDAJJSB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C3=CC=CC=C23)Cl |
Computed by PubChem (NCBI)