Products 4985-70-0
CAS 4985-70-0 is the registry number for 1-Chloroanthracene, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1-chloroanthracene (CAS 4985-70-0) is a chemical compound with the molecular formula C14H9Cl and a molecular weight of 212.67 g/mol. IUPAC name: 1-chloroanthracene. InChIKey: SRIHSAFSOOUEGL-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl |
|---|---|
| Molecular weight | 212.67 g/mol |
| IUPAC name | 1-chloroanthracene |
| InChIKey | SRIHSAFSOOUEGL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C(=CC2=C1)C=CC=C3Cl |
Computed by PubChem (NCBI)
Synonyms:
1-Chloroanthracene, SRIHSAFSOOUEGL-UHFFFAOYSA-, Anthracene, 1chloro (8CI), Anthracene, 1-chloro-(8CI), Anthracene, 1chloro (8CI)(9CI), Anthracene, 1-chloro-(8CI)(9CI), InChI=1/C14H9Cl/c15-14-7-3-6-12-8-10-4-1-2-5-11(10)9-13(12)14/h1-9H, Anthracene, 1-chloro-, CHLOROANTHRACENE, 1-chloro-anthracene