CAS 716-53-0 appears in our catalog under these names: 9-Chloroanthracene (>90%), 9–Chloroanthracene, 9-Chloroanthracene, 90+% , 9-Chloroanthracene, 9-Chloroanthracene, >98.0%(GC). Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 100mg, 1g, 250mg, 25g, 5g, 500mg, 1000mg, 5000mg.
9-chloroanthracene (CAS 716-53-0) is a chemical compound with the molecular formula C14H9Cl and a molecular weight of 212.67 g/mol. IUPAC name: 9-chloroanthracene. InChIKey: KULLJOPUZUWTMF-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl |
|---|---|
| Molecular weight | 212.67 g/mol |
| IUPAC name | 9-chloroanthracene |
| InChIKey | KULLJOPUZUWTMF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C3C=CC=CC3=C2Cl |
Computed by PubChem (NCBI)