CAS 715-51-5 appears in our catalog under these names: 3–Chlorophenanthrene, 3-Chlorophenanthrene, 99%, 99%, 3-Chlorophenanthrene, 99%, 3-Chlorophenanthrene, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
3-chlorophenanthrene (CAS 715-51-5) is a chemical compound with the molecular formula C14H9Cl and a molecular weight of 212.67 g/mol. IUPAC name: 3-chlorophenanthrene. InChIKey: BVFJTESUEYBUOL-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl |
|---|---|
| Molecular weight | 212.67 g/mol |
| IUPAC name | 3-chlorophenanthrene |
| InChIKey | BVFJTESUEYBUOL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C=C(C=C3)Cl |
Computed by PubChem (NCBI)