CAS 715-91-3 appears in our catalog under these names: 9-Cyclopentyladenine/ 99.85% (existing batch purity), 9-CYCLOPENTYLADENINE. Offered by: TargetMol, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
9-cyclopentylpurin-6-amine (CAS 715-91-3) is a chemical compound with the molecular formula C10H13N5 and a molecular weight of 203.24 g/mol. IUPAC name: 9-cyclopentylpurin-6-amine. InChIKey: KTJWHJNBTXITCB-UHFFFAOYSA-N.
| Molecular formula | C10H13N5 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 9-cyclopentylpurin-6-amine |
| InChIKey | KTJWHJNBTXITCB-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)N2C=NC3=C(N=CN=C32)N |
Computed by PubChem (NCBI)