cas: 24324-17-2 — see every product listed under this CAS number, including other names
9-Fluorenylmethanol, 98% (CAS 24324-17-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 250g, 500g, 1kg. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | M02859-10G |
| cas | 24324-17-2 |
| size | 10g |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 102.07 Pln | |
| Fluorochem | 25g | 102.07 Pln | |
| Fluorochem | 100g | 154.13 Pln | |
| Fluorochem | 250g | 294.71 Pln | |
| Fluorochem | 500g | 414.46 Pln | |
| Fluorochem | 1kg | 643.54 Pln | |
| Ambeed | 25g | 175.69 Pln | |
| Ambeed | 100g | 203.50 Pln | |
| Ambeed | 500g | 587.31 Pln | |
| Ambeed | 1kg | 804.25 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
9H-fluoren-9-ylmethanol (CAS 24324-17-2) is a chemical compound with the molecular formula C14H12O and a molecular weight of 196.24 g/mol. IUPAC name: 9H-fluoren-9-ylmethanol. InChIKey: XXSCONYSQQLHTH-UHFFFAOYSA-N.
| Molecular formula | C14H12O |
|---|---|
| Molecular weight | 196.24 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethanol |
| InChIKey | XXSCONYSQQLHTH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)CO |
Computed by PubChem (NCBI)