cas: 1573-92-8 — see every product listed under this CAS number, including other names
9-Oxo-9H-fluorene-1-carboxylic acid, ≥98%(HPLC)(T), ≥98%(HPLC)(T) (CAS 1573-92-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112PD5-1g |
| cas | 1573-92-8 |
| size | 1g |
| availability | 225g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 251.60 Pln | |
| Chemat | 5g | 635.60 Pln | |
| Chemat | 25g | 1778.00 Pln | |
| Chemat | 250mg | 146.00 Pln |
| purity | ≥98%(HPLC)(T) |
|---|---|
| delivery time | 3 weeks |
9-oxofluorene-1-carboxylic acid (CAS 1573-92-8) is a chemical compound with the molecular formula C14H8O3 and a molecular weight of 224.21 g/mol. IUPAC name: 9-oxofluorene-1-carboxylic acid. InChIKey: CBEFMGJHEKAMNI-UHFFFAOYSA-N.
| Molecular formula | C14H8O3 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | 9-oxofluorene-1-carboxylic acid |
| InChIKey | CBEFMGJHEKAMNI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C2=O)C(=CC=C3)C(=O)O |
Computed by PubChem (NCBI)