cas: 328546-66-3 — see every product listed under this CAS number, including other names
9-amino-2,3,4,5-tetrahydro-1H-1,4-benzodiazepin-5-one, 95% (CAS 328546-66-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F526172-100MG |
| cas | 328546-66-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1216.26 Pln | |
| Fluorochem | 500mg | 2361.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
9-amino-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one (CAS 328546-66-3) is a chemical compound with the molecular formula C9H11N3O and a molecular weight of 177.20 g/mol. IUPAC name: 9-amino-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one. InChIKey: XVHVPDMTBPMQAQ-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 9-amino-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one |
| InChIKey | XVHVPDMTBPMQAQ-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C2=C(N1)C(=CC=C2)N |
Computed by PubChem (NCBI)