9H,9'H-4,4'-Bicarbazole, 98%
cas: 90504-16-8 — see every product listed under this CAS number, including other names
9H,9'H-4,4'-Bicarbazole, 98% (CAS 90504-16-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 500mg. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch1333X8-50mg |
| cas | 90504-16-8 |
| size | 50mg |
| availability | 10g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 117.20 Pln | |
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 410.00 Pln | |
| Chemat | 5g | 1288.40 Pln | |
| Fluorochem | 50mg | 216.61 Pln | |
| Fluorochem | 100mg | 227.02 Pln | |
| Fluorochem | 250mg | 232.23 Pln | |
| Fluorochem | 500mg | 393.63 Pln | |
| Fluorochem | 1g | 513.38 Pln | |
| Fluorochem | 5g | 1820.21 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(9H-carbazol-4-yl)-9H-carbazole (CAS 90504-16-8) is a chemical compound with the molecular formula C24H16N2 and a molecular weight of 332.4 g/mol. IUPAC name: 4-(9H-carbazol-4-yl)-9H-carbazole. InChIKey: GDEFUYVXDBBUEJ-UHFFFAOYSA-N.
| Molecular formula | C24H16N2 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | 4-(9H-carbazol-4-yl)-9H-carbazole |
| InChIKey | GDEFUYVXDBBUEJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C=CC=C3N2)C4=C5C6=CC=CC=C6NC5=CC=C4 |
Computed by PubChem (NCBI)