9H-Carbazol-1-amine, 95%
cas: 18992-86-4 — see every product listed under this CAS number, including other names
9H-Carbazol-1-amine, 95% (CAS 18992-86-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A404031-250mg |
| cas | 18992-86-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 615.13 Pln | |
| Ambeed | 1g | 1566.31 Pln | |
| Ambeed | 5g | 5571.31 Pln | |
| Chemat | 100mg | 458.00 Pln | |
| Chemat | 250mg | 602.00 Pln | |
| Chemat | 1g | 1154.00 Pln | |
| Chemat | 10g | 10192.40 Pln | |
| BLDpharm | 100mg | 464.31 Pln | |
| BLDpharm | 250mg | 658.68 Pln | |
| BLDpharm | 1g | 1686.10 Pln | |
| BLDpharm | 5g | 6001.24 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
9H-carbazol-1-amine (CAS 18992-86-4) is a chemical compound with the molecular formula C12H10N2 and a molecular weight of 182.22 g/mol. IUPAC name: 9H-carbazol-1-amine. InChIKey: YJKJAYFKPIUBAW-UHFFFAOYSA-N.
| Molecular formula | C12H10N2 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 9H-carbazol-1-amine |
| InChIKey | YJKJAYFKPIUBAW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C(=CC=C3)N |
Computed by PubChem (NCBI)