Products 869802-44-8
CAS 869802-44-8 appears in our catalog under these names: A-794282/ min. 98%, A-794282, 98%, 98%, A-794282. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 10 mg, 5 mg.
13-(dimethylamino)-5-(4-ethylphenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one (CAS 869802-44-8) is a chemical compound with the molecular formula C19H18N4OS and a molecular weight of 350.4 g/mol. IUPAC name: 13-(dimethylamino)-5-(4-ethylphenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one. InChIKey: VCUKKMIXURRDKL-UHFFFAOYSA-N.
| Molecular formula | C19H18N4OS |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | 13-(dimethylamino)-5-(4-ethylphenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
| InChIKey | VCUKKMIXURRDKL-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)N2C=NC3=C(C2=O)SC4=NC=CC(=C34)N(C)C |
Computed by PubChem (NCBI)