Products 2445615-24-5
CAS 2445615-24-5 is the registry number for A2A/A1 AR antagonist-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[5-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-8-yl]-1-methylpyridin-2-one (CAS 2445615-24-5) is a chemical compound with the molecular formula C15H12N6O2 and a molecular weight of 308.29 g/mol. IUPAC name: 5-[5-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-8-yl]-1-methylpyridin-2-one. InChIKey: REBSCEKUSAWQBZ-UHFFFAOYSA-N.
| Molecular formula | C15H12N6O2 |
|---|---|
| Molecular weight | 308.29 g/mol |
| IUPAC name | 5-[5-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-8-yl]-1-methylpyridin-2-one |
| InChIKey | REBSCEKUSAWQBZ-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=CC1=O)C2=CN=C(N3C2=NC(=N3)C4=CC=CO4)N |
Computed by PubChem (NCBI)