cas: 58840-79-2 — see every product listed under this CAS number, including other names
AC-D-Lys-OH, 98%, 98% (CAS 58840-79-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100g, 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EJE6-10g |
| cas | 58840-79-2 |
| size | 10g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 1907.60 Pln | |
| Chemat | 100g | 12770.00 Pln | |
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 371.60 Pln | |
| Chemat | 5g | 1197.20 Pln | |
| Chemat | 25g | 3832.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-acetamido-6-aminohexanoic acid (CAS 58840-79-2) is a chemical compound with the molecular formula C8H16N2O3 and a molecular weight of 188.22 g/mol. IUPAC name: (2R)-2-acetamido-6-aminohexanoic acid. InChIKey: VEYYWZRYIYDQJM-SSDOTTSWSA-N.
| Molecular formula | C8H16N2O3 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | (2R)-2-acetamido-6-aminohexanoic acid |
| InChIKey | VEYYWZRYIYDQJM-SSDOTTSWSA-N |
| SMILES | CC(=O)N[C@H](CCCCN)C(=O)O |
Computed by PubChem (NCBI)