CAS 1115-74-8 is the registry number for (2R)-2-[(2R)-2-Amino-3-methylbutanamido]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Val-Ala is a dipeptide formed from L-valine and L-alanine residues. It has a role as a metabolite.
Source: ChEBI
| Molecular formula | C8H16N2O3 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]propanoic acid |
| InChIKey | HSRXSKHRSXRCFC-WDSKDSINSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)[C@H](C(C)C)N |
Computed by PubChem (NCBI)