CAS 91533-02-7 appears in our catalog under these names: AF 399/ 99.21% (existing batch purity), AF 399, HTS13517. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
2-pyrrolidin-1-yl-N-(4-sulfamoylphenyl)acetamide (CAS 91533-02-7) is a chemical compound with the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. IUPAC name: 2-pyrrolidin-1-yl-N-(4-sulfamoylphenyl)acetamide. InChIKey: CRDXWPKUELSCSF-UHFFFAOYSA-N.
| Molecular formula | C12H17N3O3S |
|---|---|
| Molecular weight | 283.35 g/mol |
| IUPAC name | 2-pyrrolidin-1-yl-N-(4-sulfamoylphenyl)acetamide |
| InChIKey | CRDXWPKUELSCSF-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)CC(=O)NC2=CC=C(C=C2)S(=O)(=O)N |
Computed by PubChem (NCBI)