Products 330834-54-3
CAS 330834-54-3 appears in our catalog under these names: N-(3-(Benzo[d][1,3]dioxol-5-yl)-3-(2-methoxyphenyl)propyl)-N-benzylpropionamide, 99.85% ,, 99.85% ,, AGX51/ 99.85% (existing batch purity), AGX51, AGX51 98%, AGX51, 99.33%. Offered by: Chemat, TargetMol, GLPBio, Ambeed, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
N-[3-(1,3-benzodioxol-5-yl)-3-(2-methoxyphenyl)propyl]-N-benzylpropanamide (CAS 330834-54-3) is a chemical compound with the molecular formula C27H29NO4 and a molecular weight of 431.5 g/mol. IUPAC name: N-[3-(1,3-benzodioxol-5-yl)-3-(2-methoxyphenyl)propyl]-N-benzylpropanamide. InChIKey: SRADCMOCDMFMPS-UHFFFAOYSA-N.
| Molecular formula | C27H29NO4 |
|---|---|
| Molecular weight | 431.5 g/mol |
| IUPAC name | N-[3-(1,3-benzodioxol-5-yl)-3-(2-methoxyphenyl)propyl]-N-benzylpropanamide |
| InChIKey | SRADCMOCDMFMPS-UHFFFAOYSA-N |
| SMILES | CCC(=O)N(CCC(C1=CC2=C(C=C1)OCO2)C3=CC=CC=C3OC)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)