Products 732277-05-3
CAS 732277-05-3 appears in our catalog under these names: AMPA/kainate antagonist–1, AMPA receptor antagonist-2/ 98.21% (existing batch purity), AMPA receptor antagonist-2. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 100mg, 1 mg.
(8R)-8-methyl-5-(3-methyl-4-nitrophenyl)-8,9-dihydro-7H-[1,3]dioxolo[4,5-h][2,3]benzodiazepine (CAS 732277-05-3) is a chemical compound with the molecular formula C18H17N3O4 and a molecular weight of 339.3 g/mol. IUPAC name: (8R)-8-methyl-5-(3-methyl-4-nitrophenyl)-8,9-dihydro-7H-[1,3]dioxolo[4,5-h][2,3]benzodiazepine. InChIKey: SXFGVEYSGPJCQX-LLVKDONJSA-N.
| Molecular formula | C18H17N3O4 |
|---|---|
| Molecular weight | 339.3 g/mol |
| IUPAC name | (8R)-8-methyl-5-(3-methyl-4-nitrophenyl)-8,9-dihydro-7H-[1,3]dioxolo[4,5-h][2,3]benzodiazepine |
| InChIKey | SXFGVEYSGPJCQX-LLVKDONJSA-N |
| SMILES | C[C@@H]1CC2=CC3=C(C=C2C(=NN1)C4=CC(=C(C=C4)[N+](=O)[O-])C)OCO3 |
Computed by PubChem (NCBI)